About 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one
1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one (PubChem CID 122181277) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one |
| PubChem CID | 122181277 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one |
| SMILES | COc1cc(/C=C/c2ccc(N3CCNC3=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O4/c1-24-17-12-15(13-18(25-2)19(17)26-3)5-4-14-6-8-16(9-7-14)22-11-10-21-20(22)23/h4-9,12-13H,10-11H2,1-3H3,(H,21,23)/b5-4+ |
| InChIKey | DGQCLYJBZHNLFX-SNAWJCMRSA-N |
| XLogP | 3.41 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one?
The IUPAC name of 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one (CID 122181277) is 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one.
What is the SMILES notation for 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one?
The canonical SMILES for 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one is COc1cc(/C=C/c2ccc(N3CCNC3=O)cc2)cc(OC)c1OC.
What is the InChIKey of 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one?
The InChIKey is DGQCLYJBZHNLFX-SNAWJCMRSA-N. The full InChI is InChI=1S/C20H22N2O4/c1-24-17-12-15(13-18(25-2)19(17)26-3)5-4-14-6-8-16(9-7-14)22-11-10-21-20(22)23/h4-9,12-13H,10-11H2,1-3H3,(H,21,23)/b5-4+.
What are the key properties of 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one?
1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one has a molecular weight of 354.41 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]imidazolidin-2-one is sourced from PubChem (CID 122181277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).