About (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide
(E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 122181333) has the molecular formula C23H27FN2O
and a molecular weight of 366.48 g/mol. Its IUPAC name is (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide |
| PubChem CID | 122181333 |
| Molecular Formula | C23H27FN2O |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CCCN(CCNC(=O)/C=C/c1ccc(F)cc1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H27FN2O/c1-2-14-26(22-16-19-5-3-4-6-20(19)17-22)15-13-25-23(27)12-9-18-7-10-21(24)11-8-18/h3-12,22H,2,13-17H2,1H3,(H,25,27)/b12-9+ |
| InChIKey | RBFMCJMIEVSALT-FMIVXFBMSA-N |
| XLogP | 3.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide?
The IUPAC name of (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide (CID 122181333) is (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide.
What is the SMILES notation for (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide?
The canonical SMILES for (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide is CCCN(CCNC(=O)/C=C/c1ccc(F)cc1)C1Cc2ccccc2C1.
What is the InChIKey of (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide?
The InChIKey is RBFMCJMIEVSALT-FMIVXFBMSA-N. The full InChI is InChI=1S/C23H27FN2O/c1-2-14-26(22-16-19-5-3-4-6-20(19)17-22)15-13-25-23(27)12-9-18-7-10-21(24)11-8-18/h3-12,22H,2,13-17H2,1H3,(H,25,27)/b12-9+.
What are the key properties of (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide?
(E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide has a molecular weight of 366.48 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[2-[2,3-dihydro-1H-inden-2-yl(propyl)amino]ethyl]-3-(4-fluorophenyl)prop-2-enamide is sourced from PubChem (CID 122181333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).