C28H35ClN4O2 — CID 122181346
3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-6-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 122181346) has the molecular formula C28H35ClN4O2 and a molecular weight of 495.07 g/mol. Its IUPAC name is 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-6-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-6-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 122181346 |
| Molecular Formula | C28H35ClN4O2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-6-phenyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC2(CCCCC2c2ccccc2)C(=O)N1CCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C28H35ClN4O2/c29-23-11-8-12-24(21-23)32-19-17-31(18-20-32)15-6-7-16-33-26(34)28(30-27(33)35)14-5-4-13-25(28)22-9-2-1-3-10-22/h1-3,8-12,21,25H,4-7,13-20H2,(H,30,35) |
| InChIKey | GMCBLGFSNMWJPX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|