About N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide
N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide (PubChem CID 122181434) has the molecular formula C16H13N3O7S
and a molecular weight of 391.36 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide |
| PubChem CID | 122181434 |
| Molecular Formula | C16H13N3O7S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(c1cccc(OC)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13N3O7S/c1-3-9-17(12-5-4-6-14(10-12)26-2)27(24,25)16-8-7-13(18(20)21)11-15(16)19(22)23/h1,4-8,10-11H,9H2,2H3 |
| InChIKey | VHWDMAURNJWIRO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide?
The IUPAC name of N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide (CID 122181434) is N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide.
What is the SMILES notation for N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide?
The canonical SMILES for N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide is C#CCN(c1cccc(OC)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide?
The InChIKey is VHWDMAURNJWIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O7S/c1-3-9-17(12-5-4-6-14(10-12)26-2)27(24,25)16-8-7-13(18(20)21)11-15(16)19(22)23/h1,4-8,10-11H,9H2,2H3.
What are the key properties of N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide?
N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide has a molecular weight of 391.36 g/mol, XLogP of 2.34, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-2,4-dinitro-N-prop-2-ynylbenzenesulfonamide is sourced from PubChem (CID 122181434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).