C20H32O2 — CID 122181510
(1S,2R,4aR,4bS,8R,8aR)-2-ethenyl-8-(hydroxymethyl)-2,4b,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-1-ol (PubChem CID 122181510) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2R,4aR,4bS,8R,8aR)-2-ethenyl-8-(hydroxymethyl)-2,4b,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-1-ol.
| Compound Name | (1S,2R,4aR,4bS,8R,8aR)-2-ethenyl-8-(hydroxymethyl)-2,4b,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-1-ol |
|---|---|
| PubChem CID | 122181510 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2R,4aR,4bS,8R,8aR)-2-ethenyl-8-(hydroxymethyl)-2,4b,8-trimethyl-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthren-1-ol |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(=CC[C@H]3[C@](C)(CO)CCC[C@]23C)[C@H]1O |
| InChI | InChI=1S/C20H32O2/c1-5-18(2)12-9-15-14(17(18)22)7-8-16-19(3,13-21)10-6-11-20(15,16)4/h5,7,15-17,21-22H,1,6,8-13H2,2-4H3/t15-,16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | OGDKBMIXPVDZEL-CFSBILQPSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|