C19H21F5N8O — CID 122181632
5-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 122181632) has the molecular formula C19H21F5N8O and a molecular weight of 472.42 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 122181632 |
| Molecular Formula | C19H21F5N8O |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 5-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-4-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cnn3ccc(N[C@@H]4CCCC[C@@H]4N)nc23)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C19H21F5N8O/c1-31-9-13(15(30-31)18(20,21)19(22,23)24)28-17(33)10-8-26-32-7-6-14(29-16(10)32)27-12-5-3-2-4-11(12)25/h6-9,11-12H,2-5,25H2,1H3,(H,27,29)(H,28,33)/t11-,12+/m0/s1 |
| InChIKey | WDNTUDCNGIFBAQ-NWDGAFQWSA-N |
| XLogP | 3.05 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|