About (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one
(1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one (PubChem CID 122181668) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one.
Molecular Properties
| Compound Name | (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one |
| PubChem CID | 122181668 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one |
| SMILES | CCCCCCCCCCCC1CC=C/C(=C\C(C)=O)O1 |
| InChI | InChI=1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-13-18-14-12-15-19(21-18)16-17(2)20/h12,15-16,18H,3-11,13-14H2,1-2H3/b19-16+ |
| InChIKey | ZDOQVHVFJATDRW-KNTRCKAVSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one?
The IUPAC name of (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one (CID 122181668) is (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one.
What is the SMILES notation for (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one?
The canonical SMILES for (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one is CCCCCCCCCCCC1CC=C/C(=C\C(C)=O)O1.
What is the InChIKey of (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one?
The InChIKey is ZDOQVHVFJATDRW-KNTRCKAVSA-N. The full InChI is InChI=1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-13-18-14-12-15-19(21-18)16-17(2)20/h12,15-16,18H,3-11,13-14H2,1-2H3/b19-16+.
What are the key properties of (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one?
(1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one has a molecular weight of 292.46 g/mol, XLogP of 5.73, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(2-undecyl-2,3-dihydropyran-6-ylidene)propan-2-one is sourced from PubChem (CID 122181668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).