About [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride
[4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride (PubChem CID 122181784) has the molecular formula C13H18Cl3NO
and a molecular weight of 310.65 g/mol. Its IUPAC name is [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride |
| PubChem CID | 122181784 |
| Molecular Formula | C13H18Cl3NO |
| Molecular Weight | 310.65 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride |
| SMILES | Cl.OCC1(c2ccc(Cl)c(Cl)c2)CCCNCC1 |
| InChI | InChI=1S/C13H17Cl2NO.ClH/c14-11-3-2-10(8-12(11)15)13(9-17)4-1-6-16-7-5-13;/h2-3,8,16-17H,1,4-7,9H2;1H |
| InChIKey | KETAPAGKHJIKAN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride?
The IUPAC name of [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride (CID 122181784) is [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride.
What is the SMILES notation for [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride?
The canonical SMILES for [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride is Cl.OCC1(c2ccc(Cl)c(Cl)c2)CCCNCC1.
What is the InChIKey of [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride?
The InChIKey is KETAPAGKHJIKAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NO.ClH/c14-11-3-2-10(8-12(11)15)13(9-17)4-1-6-16-7-5-13;/h2-3,8,16-17H,1,4-7,9H2;1H.
What are the key properties of [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride?
[4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride has a molecular weight of 310.65 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dichlorophenyl)azepan-4-yl]methanol;hydrochloride is sourced from PubChem (CID 122181784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).