C30H44O6 — CID 122181856
(Z,6R)-6-[(2R,4aS,4bS,7R,8S,9aS)-8-(carboxymethyl)-7-(2-carboxypropan-2-yl)-4a,8-dimethyl-1-methylidene-2,3,4,4b,5,6,7,9a-octahydrofluoren-2-yl]-2-methylhept-2-enoic acid (PubChem CID 122181856) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (Z,6R)-6-[(2R,4aS,4bS,7R,8S,9aS)-8-(carboxymethyl)-7-(2-carboxypropan-2-yl)-4a,8-dimethyl-1-methylidene-2,3,4,4b,5,6,7,9a-octahydrofluoren-2-yl]-2-methylhept-2-enoic acid.
| Compound Name | (Z,6R)-6-[(2R,4aS,4bS,7R,8S,9aS)-8-(carboxymethyl)-7-(2-carboxypropan-2-yl)-4a,8-dimethyl-1-methylidene-2,3,4,4b,5,6,7,9a-octahydrofluoren-2-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 122181856 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (Z,6R)-6-[(2R,4aS,4bS,7R,8S,9aS)-8-(carboxymethyl)-7-(2-carboxypropan-2-yl)-4a,8-dimethyl-1-methylidene-2,3,4,4b,5,6,7,9a-octahydrofluoren-2-yl]-2-methylhept-2-enoic acid |
| SMILES | C=C1[C@@H]([C@H](C)CC/C=C(/C)C(=O)O)CC[C@@]2(C)[C@@H]3CC[C@@H](C(C)(C)C(=O)O)[C@](C)(CC(=O)O)C3=C[C@@H]12 |
| InChI | InChI=1S/C30H44O6/c1-17(9-8-10-18(2)26(33)34)20-13-14-29(6)21-11-12-24(28(4,5)27(35)36)30(7,16-25(31)32)23(21)15-22(29)19(20)3/h10,15,17,20-22,24H,3,8-9,11-14,16H2,1-2,4-7H3,(H,31,32)(H,33,34)(H,35,36)/b18-10-/t17-,20-,21-,22+,24+,29+,30-/m1/s1 |
| InChIKey | OPHWLZKCIGFGFZ-YYPBCPHMSA-N |
| XLogP | 6.58 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|