C31H45N5O4S2 — CID 122181884
S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3-thia-7,10,14,17,21-pentazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate (PubChem CID 122181884) has the molecular formula C31H45N5O4S2 and a molecular weight of 615.87 g/mol. Its IUPAC name is S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3-thia-7,10,14,17,21-pentazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3-thia-7,10,14,17,21-pentazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 122181884 |
| Molecular Formula | C31H45N5O4S2 |
| Molecular Weight | 615.87 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3-thia-7,10,14,17,21-pentazatricyclo[14.3.1.12,5]henicosa-1(20),2(21),16,18-tetraen-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2cc(ccn2)C2=N[C@@](C)(CS2)C(=O)N[C@@H](C(C)C)C(=O)N1 |
| InChI | InChI=1S/C31H45N5O4S2/c1-5-6-7-8-9-13-26(38)41-16-11-10-12-23-18-25(37)33-19-24-17-22(14-15-32-24)29-36-31(4,20-42-29)30(40)35-27(21(2)3)28(39)34-23/h10,12,14-15,17,21,23,27H,5-9,11,13,16,18-20H2,1-4H3,(H,33,37)(H,34,39)(H,35,40)/b12-10+/t23-,27+,31+/m1/s1 |
| InChIKey | NKGWWCVZTYBVCU-DQCRRJJISA-N |
| XLogP | 4.55 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|