C20H20F3N7 — CID 122181976
(3aR,6aS)-2-[4-methyl-6-(2H-tetrazol-5-yl)pyrimidin-2-yl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 122181976) has the molecular formula C20H20F3N7 and a molecular weight of 415.42 g/mol. Its IUPAC name is (3aR,6aS)-2-[4-methyl-6-(2H-tetrazol-5-yl)pyrimidin-2-yl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-2-[4-methyl-6-(2H-tetrazol-5-yl)pyrimidin-2-yl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 122181976 |
| Molecular Formula | C20H20F3N7 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (3aR,6aS)-2-[4-methyl-6-(2H-tetrazol-5-yl)pyrimidin-2-yl]-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | Cc1cc(-c2nn[nH]n2)nc(N2C[C@H]3CC(c4ccccc4C(F)(F)F)C[C@H]3C2)n1 |
| InChI | InChI=1S/C20H20F3N7/c1-11-6-17(18-26-28-29-27-18)25-19(24-11)30-9-13-7-12(8-14(13)10-30)15-4-2-3-5-16(15)20(21,22)23/h2-6,12-14H,7-10H2,1H3,(H,26,27,28,29)/t12?,13-,14+ |
| InChIKey | XGOVWOMAPLBWDT-AGUYFDCRSA-N |
| XLogP | 3.61 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |