C19H18F3N3O2 — CID 122181981
6-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyrazine-2-carboxylic acid (PubChem CID 122181981) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 6-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyrazine-2-carboxylic acid.
| Compound Name | 6-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122181981 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 6-[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cncc(N2C[C@H]3CC(c4ccccc4C(F)(F)F)C[C@H]3C2)n1 |
| InChI | InChI=1S/C19H18F3N3O2/c20-19(21,22)15-4-2-1-3-14(15)11-5-12-9-25(10-13(12)6-11)17-8-23-7-16(24-17)18(26)27/h1-4,7-8,11-13H,5-6,9-10H2,(H,26,27)/t11?,12-,13+ |
| InChIKey | UVEJRJPZBPVTTB-YHWZYXNKSA-N |
| XLogP | 3.82 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |