C20H19F4N3O2 — CID 122181984
2-[(3aR,6aS)-5-[3-fluoro-2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-methylpyrimidine-4-carboxylic acid (PubChem CID 122181984) has the molecular formula C20H19F4N3O2 and a molecular weight of 409.38 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-[3-fluoro-2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-methylpyrimidine-4-carboxylic acid.
| Compound Name | 2-[(3aR,6aS)-5-[3-fluoro-2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-methylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122181984 |
| Molecular Formula | C20H19F4N3O2 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 2-[(3aR,6aS)-5-[3-fluoro-2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-6-methylpyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nc(N2C[C@H]3CC(c4cccc(F)c4C(F)(F)F)C[C@H]3C2)n1 |
| InChI | InChI=1S/C20H19F4N3O2/c1-10-5-16(18(28)29)26-19(25-10)27-8-12-6-11(7-13(12)9-27)14-3-2-4-15(21)17(14)20(22,23)24/h2-5,11-13H,6-9H2,1H3,(H,28,29)/t11?,12-,13+ |
| InChIKey | GXMIZLNOUJHGFA-YHWZYXNKSA-N |
| XLogP | 4.27 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |