C25H22BN5O2 — CID 122182052
N-[4-(1H-1,2-benzazaborinin-2-ylmethoxy)phenyl]-N-methyl-3-pyridin-2-yl-1H-pyrazole-5-carboxamide (PubChem CID 122182052) has the molecular formula C25H22BN5O2 and a molecular weight of 435.30 g/mol. Its IUPAC name is N-[4-(1H-1,2-benzazaborinin-2-ylmethoxy)phenyl]-N-methyl-3-pyridin-2-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(1H-1,2-benzazaborinin-2-ylmethoxy)phenyl]-N-methyl-3-pyridin-2-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122182052 |
| Molecular Formula | C25H22BN5O2 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-[4-(1H-1,2-benzazaborinin-2-ylmethoxy)phenyl]-N-methyl-3-pyridin-2-yl-1H-pyrazole-5-carboxamide |
| SMILES | CN(C(=O)c1cc(-c2ccccn2)n[nH]1)c1ccc(OCB2C=Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C25H22BN5O2/c1-31(25(32)24-16-23(29-30-24)22-8-4-5-15-27-22)19-9-11-20(12-10-19)33-17-26-14-13-18-6-2-3-7-21(18)28-26/h2-16,28H,17H2,1H3,(H,29,30) |
| InChIKey | MYTNPSGFCIPNAD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|