C23H21N5O2 — CID 122182071
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(7-ethynylimidazo[1,2-a]pyridin-2-yl)phenyl]urea (PubChem CID 122182071) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(7-ethynylimidazo[1,2-a]pyridin-2-yl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(7-ethynylimidazo[1,2-a]pyridin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 122182071 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(7-ethynylimidazo[1,2-a]pyridin-2-yl)phenyl]urea |
| SMILES | C#Cc1ccn2cc(-c3ccc(NC(=O)Nc4cc(C(C)(C)C)on4)cc3)nc2c1 |
| InChI | InChI=1S/C23H21N5O2/c1-5-15-10-11-28-14-18(25-21(28)12-15)16-6-8-17(9-7-16)24-22(29)26-20-13-19(30-27-20)23(2,3)4/h1,6-14H,2-4H3,(H2,24,26,27,29) |
| InChIKey | IAXKUVADJMIUSK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|