C21H20ClN5O2 — CID 122182082
1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(5-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]urea (PubChem CID 122182082) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(5-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(5-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 122182082 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 1-(5-tert-butyl-1,2-oxazol-3-yl)-3-[4-(5-chloroimidazo[1,2-a]pyridin-2-yl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3cn4c(Cl)cccc4n3)cc2)no1 |
| InChI | InChI=1S/C21H20ClN5O2/c1-21(2,3)16-11-18(26-29-16)25-20(28)23-14-9-7-13(8-10-14)15-12-27-17(22)5-4-6-19(27)24-15/h4-12H,1-3H3,(H2,23,25,26,28) |
| InChIKey | BYAHAUUZDPJGSS-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|