About 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine
2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine (PubChem CID 122182084) has the molecular formula C18H26N4O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine |
| PubChem CID | 122182084 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cncc(-c2cncc(OCCN(C)C)c2)c1 |
| InChI | InChI=1S/C18H26N4O2/c1-21(2)5-7-23-17-9-15(11-19-13-17)16-10-18(14-20-12-16)24-8-6-22(3)4/h9-14H,5-8H2,1-4H3 |
| InChIKey | HLXBLFRALJAWET-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine?
The IUPAC name of 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine (CID 122182084) is 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine?
The canonical SMILES for 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine is CN(C)CCOc1cncc(-c2cncc(OCCN(C)C)c2)c1.
What is the InChIKey of 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine?
The InChIKey is HLXBLFRALJAWET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O2/c1-21(2)5-7-23-17-9-15(11-19-13-17)16-10-18(14-20-12-16)24-8-6-22(3)4/h9-14H,5-8H2,1-4H3.
What are the key properties of 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine?
2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine has a molecular weight of 330.43 g/mol, XLogP of 2.02, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-[5-[2-(dimethylamino)ethoxy]-3-pyridinyl]-3-pyridinyl]oxy]-N,N-dimethylethanamine is sourced from PubChem (CID 122182084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).