About 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine
2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine (PubChem CID 122182212) has the molecular formula C15H23F2N3O
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine |
| PubChem CID | 122182212 |
| Molecular Formula | C15H23F2N3O |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cc(N2CCN(C)CC2)cc(F)c1F |
| InChI | InChI=1S/C15H23F2N3O/c1-18(2)8-9-21-14-11-12(10-13(16)15(14)17)20-6-4-19(3)5-7-20/h10-11H,4-9H2,1-3H3 |
| InChIKey | BWPQQUNAHHQNLP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine?
The IUPAC name of 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine (CID 122182212) is 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine?
The canonical SMILES for 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine is CN(C)CCOc1cc(N2CCN(C)CC2)cc(F)c1F.
What is the InChIKey of 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine?
The InChIKey is BWPQQUNAHHQNLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N3O/c1-18(2)8-9-21-14-11-12(10-13(16)15(14)17)20-6-4-19(3)5-7-20/h10-11H,4-9H2,1-3H3.
What are the key properties of 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine?
2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine has a molecular weight of 299.37 g/mol, XLogP of 1.66, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-difluoro-5-(4-methylpiperazin-1-yl)phenoxy]-N,N-dimethylethanamine is sourced from PubChem (CID 122182212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).