About (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone
(2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone (PubChem CID 122182222) has the molecular formula C19H19NO5
and a molecular weight of 341.36 g/mol. Its IUPAC name is (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone.
Molecular Properties
| Compound Name | (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone |
| PubChem CID | 122182222 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone |
| SMILES | COc1cc(C(=O)c2ccc3c(ccn3C)c2)c(O)c(OC)c1OC |
| InChI | InChI=1S/C19H19NO5/c1-20-8-7-11-9-12(5-6-14(11)20)16(21)13-10-15(23-2)18(24-3)19(25-4)17(13)22/h5-10,22H,1-4H3 |
| InChIKey | GESIDFQWZILMBW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone?
The IUPAC name of (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone (CID 122182222) is (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone.
What is the SMILES notation for (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone?
The canonical SMILES for (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone is COc1cc(C(=O)c2ccc3c(ccn3C)c2)c(O)c(OC)c1OC.
What is the InChIKey of (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone?
The InChIKey is GESIDFQWZILMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO5/c1-20-8-7-11-9-12(5-6-14(11)20)16(21)13-10-15(23-2)18(24-3)19(25-4)17(13)22/h5-10,22H,1-4H3.
What are the key properties of (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone?
(2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone has a molecular weight of 341.36 g/mol, XLogP of 3.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3,4,5-trimethoxyphenyl)-(1-methylindol-5-yl)methanone is sourced from PubChem (CID 122182222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).