C18H17N3O — CID 122182252
(3Z)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 122182252) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (3Z)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3Z)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 122182252 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (3Z)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | CN(C)c1ccc(/C=C/C=C2\C(=O)Nc3ncccc32)cc1 |
| InChI | InChI=1S/C18H17N3O/c1-21(2)14-10-8-13(9-11-14)5-3-6-16-15-7-4-12-19-17(15)20-18(16)22/h3-12H,1-2H3,(H,19,20,22)/b5-3+,16-6- |
| InChIKey | KLWMYERGKGRVCC-QCWVPXHQSA-N |
| XLogP | 3.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|