About N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine
N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine (PubChem CID 122182337) has the molecular formula C21H34N6O2
and a molecular weight of 402.54 g/mol. Its IUPAC name is N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine.
Molecular Properties
| Compound Name | N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine |
| PubChem CID | 122182337 |
| Molecular Formula | C21H34N6O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine |
| SMILES | COc1cc(C(N)N)ccc1NCCCCCNc1ccc(C(N)N)cc1OC |
| InChI | InChI=1S/C21H34N6O2/c1-28-18-12-14(20(22)23)6-8-16(18)26-10-4-3-5-11-27-17-9-7-15(21(24)25)13-19(17)29-2/h6-9,12-13,20-21,26-27H,3-5,10-11,22-25H2,1-2H3 |
| InChIKey | QZQYZSYKDUFQST-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine?
The IUPAC name of N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine (CID 122182337) is N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine.
What is the SMILES notation for N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine?
The canonical SMILES for N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine is COc1cc(C(N)N)ccc1NCCCCCNc1ccc(C(N)N)cc1OC.
What is the InChIKey of N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine?
The InChIKey is QZQYZSYKDUFQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34N6O2/c1-28-18-12-14(20(22)23)6-8-16(18)26-10-4-3-5-11-27-17-9-7-15(21(24)25)13-19(17)29-2/h6-9,12-13,20-21,26-27H,3-5,10-11,22-25H2,1-2H3.
What are the key properties of N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine?
N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine has a molecular weight of 402.54 g/mol, XLogP of 2.23, 12 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis[4-(diaminomethyl)-2-methoxyphenyl]pentane-1,5-diamine is sourced from PubChem (CID 122182337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).