About 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole
9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole (PubChem CID 122182382) has the molecular formula C26H27NO3
and a molecular weight of 401.51 g/mol. Its IUPAC name is 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole.
Molecular Properties
| Compound Name | 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole |
| PubChem CID | 122182382 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole |
| SMILES | C/C=C(/c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C26H27NO3/c1-6-19(18-15-24(28-3)26(30-5)25(16-18)29-4)17-12-13-23-21(14-17)20-10-8-9-11-22(20)27(23)7-2/h6,8-16H,7H2,1-5H3/b19-6+ |
| InChIKey | HCFHRVMHEKGQRL-KPSZGOFPSA-N |
| XLogP | 6.29 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole?
The IUPAC name of 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole (CID 122182382) is 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole.
What is the SMILES notation for 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole?
The canonical SMILES for 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole is C/C=C(/c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)c1ccccc1n2CC.
What is the InChIKey of 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole?
The InChIKey is HCFHRVMHEKGQRL-KPSZGOFPSA-N. The full InChI is InChI=1S/C26H27NO3/c1-6-19(18-15-24(28-3)26(30-5)25(16-18)29-4)17-12-13-23-21(14-17)20-10-8-9-11-22(20)27(23)7-2/h6,8-16H,7H2,1-5H3/b19-6+.
What are the key properties of 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole?
9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole has a molecular weight of 401.51 g/mol, XLogP of 6.29, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3-[(E)-1-(3,4,5-trimethoxyphenyl)prop-1-enyl]carbazole is sourced from PubChem (CID 122182382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).