About 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one
2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 122182443) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| PubChem CID | 122182443 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=C1NC(c2ccc(OCc3ccccc3)cc2)Nc2ncccc21 |
| InChI | InChI=1S/C20H17N3O2/c24-20-17-7-4-12-21-19(17)22-18(23-20)15-8-10-16(11-9-15)25-13-14-5-2-1-3-6-14/h1-12,18H,13H2,(H,21,22)(H,23,24) |
| InChIKey | JIPQXFWUONVUSA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
The IUPAC name of 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one (CID 122182443) is 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
The canonical SMILES for 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one is O=C1NC(c2ccc(OCc3ccccc3)cc2)Nc2ncccc21.
What is the InChIKey of 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
The InChIKey is JIPQXFWUONVUSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c24-20-17-7-4-12-21-19(17)22-18(23-20)15-8-10-16(11-9-15)25-13-14-5-2-1-3-6-14/h1-12,18H,13H2,(H,21,22)(H,23,24).
What are the key properties of 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one?
2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one has a molecular weight of 331.38 g/mol, XLogP of 3.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylmethoxyphenyl)-2,3-dihydro-1H-pyrido[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 122182443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).