C23H40O5 — CID 122182474
[3-[(2R,3aS,5aS,9aS,9bS)-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalen-2-yl]-2,3,4-trihydroxybutyl] acetate (PubChem CID 122182474) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is [3-[(2R,3aS,5aS,9aS,9bS)-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalen-2-yl]-2,3,4-trihydroxybutyl] acetate.
| Compound Name | [3-[(2R,3aS,5aS,9aS,9bS)-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalen-2-yl]-2,3,4-trihydroxybutyl] acetate |
|---|---|
| PubChem CID | 122182474 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | [3-[(2R,3aS,5aS,9aS,9bS)-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalen-2-yl]-2,3,4-trihydroxybutyl] acetate |
| SMILES | CC(=O)OCC(O)C(O)(CO)[C@@H]1C[C@H]2[C@@](C)(CC[C@H]3C(C)(C)CCC[C@@]32C)C1 |
| InChI | InChI=1S/C23H40O5/c1-15(25)28-13-19(26)23(27,14-24)16-11-18-21(4,12-16)10-7-17-20(2,3)8-6-9-22(17,18)5/h16-19,24,26-27H,6-14H2,1-5H3/t16-,17+,18+,19?,21+,22+,23?/m1/s1 |
| InChIKey | HDYYOZGCKVOQKY-JSLBDLRZSA-N |
| XLogP | 3.29 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |