C30H52O4 — CID 122182476
(6E,10E,14E,17E)-18-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,10,15-tetramethyloctadeca-6,10,14,17-tetraene-2,3-diol (PubChem CID 122182476) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is (6E,10E,14E,17E)-18-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,10,15-tetramethyloctadeca-6,10,14,17-tetraene-2,3-diol.
| Compound Name | (6E,10E,14E,17E)-18-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,10,15-tetramethyloctadeca-6,10,14,17-tetraene-2,3-diol |
|---|---|
| PubChem CID | 122182476 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (6E,10E,14E,17E)-18-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-2,6,10,15-tetramethyloctadeca-6,10,14,17-tetraene-2,3-diol |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CCC(O)C(C)(C)O)C/C=C/[C@@]1(C)CC[C@@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C30H52O4/c1-23(15-11-16-25(3)18-19-26(31)28(4,5)32)13-9-10-14-24(2)17-12-21-30(8)22-20-27(34-30)29(6,7)33/h12-14,16,21,26-27,31-33H,9-11,15,17-20,22H2,1-8H3/b21-12+,23-13+,24-14+,25-16+/t26?,27-,30-/m0/s1 |
| InChIKey | TZNGZNFIMYBBEC-MKBBOFQQSA-N |
| XLogP | 6.95 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|