C35H38ClN3S2Se — CID 122182494
piperidin-1-yl-[5-(3-selena-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)thiophen-2-yl]methanethione chloride (PubChem CID 122182494) has the molecular formula C35H38ClN3S2Se and a molecular weight of 679.26 g/mol. Its IUPAC name is piperidin-1-yl-[5-(3-selena-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)thiophen-2-yl]methanethione chloride.
| Compound Name | piperidin-1-yl-[5-(3-selena-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)thiophen-2-yl]methanethione chloride |
|---|---|
| PubChem CID | 122182494 |
| Molecular Formula | C35H38ClN3S2Se |
| Molecular Weight | 679.26 g/mol |
| Exact Mass | 679.14 |
| IUPAC Name | piperidin-1-yl-[5-(3-selena-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)thiophen-2-yl]methanethione chloride |
| SMILES | S=C(c1ccc(C2=c3cc4c5c(c3[Se]c3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)s1)N1CCCCC1.[Cl-] |
| InChI | InChI=1S/C35H38N3S2Se.ClH/c39-35(38-14-2-1-3-15-38)29-13-12-28(40-29)30-26-20-22-8-4-16-36-18-6-10-24(31(22)36)33(26)41-34-25-11-7-19-37-17-5-9-23(32(25)37)21-27(30)34;/h12-13,20-21H,1-11,14-19H2;1H/q+1;/p-1 |
| InChIKey | QHGQNKHOWQFGPI-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|