C20H30O4 — CID 122182582
(1S,4aR,6R,8aR)-6-hydroxy-5,5,8a-trimethyl-3'-propan-2-ylspiro[4a,6,7,8-tetrahydro-4H-isochromene-1,6'-cyclohex-2-ene]-1',3-dione (PubChem CID 122182582) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,4aR,6R,8aR)-6-hydroxy-5,5,8a-trimethyl-3'-propan-2-ylspiro[4a,6,7,8-tetrahydro-4H-isochromene-1,6'-cyclohex-2-ene]-1',3-dione.
| Compound Name | (1S,4aR,6R,8aR)-6-hydroxy-5,5,8a-trimethyl-3'-propan-2-ylspiro[4a,6,7,8-tetrahydro-4H-isochromene-1,6'-cyclohex-2-ene]-1',3-dione |
|---|---|
| PubChem CID | 122182582 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,4aR,6R,8aR)-6-hydroxy-5,5,8a-trimethyl-3'-propan-2-ylspiro[4a,6,7,8-tetrahydro-4H-isochromene-1,6'-cyclohex-2-ene]-1',3-dione |
| SMILES | CC(C)C1=CC(=O)[C@@]2(CC1)OC(=O)C[C@@H]1C(C)(C)[C@H](O)CC[C@]12C |
| InChI | InChI=1S/C20H30O4/c1-12(2)13-6-9-20(16(22)10-13)19(5)8-7-15(21)18(3,4)14(19)11-17(23)24-20/h10,12,14-15,21H,6-9,11H2,1-5H3/t14-,15-,19-,20-/m1/s1 |
| InChIKey | KFEZPUHNOOFISQ-PBGAUENZSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |