C21H34O3 — CID 122182585
(2R,4aR,4bS,7R,10aS)-2-hydroxy-7-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-9-one (PubChem CID 122182585) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2R,4aR,4bS,7R,10aS)-2-hydroxy-7-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-9-one.
| Compound Name | (2R,4aR,4bS,7R,10aS)-2-hydroxy-7-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-9-one |
|---|---|
| PubChem CID | 122182585 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2R,4aR,4bS,7R,10aS)-2-hydroxy-7-methoxy-1,1,4a-trimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-9-one |
| SMILES | CO[C@]1(C(C)C)C=C2C(=O)C[C@@H]3C(C)(C)[C@H](O)CC[C@@]3(C)[C@@H]2CC1 |
| InChI | InChI=1S/C21H34O3/c1-13(2)21(24-6)10-7-15-14(12-21)16(22)11-17-19(3,4)18(23)8-9-20(15,17)5/h12-13,15,17-18,23H,7-11H2,1-6H3/t15-,17-,18-,20+,21+/m1/s1 |
| InChIKey | LPYIFWOTSGRWLD-WLJLVMMNSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |