About (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide
(1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide (PubChem CID 122182686) has the molecular formula C13H19BrO3S
and a molecular weight of 335.26 g/mol. Its IUPAC name is (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide.
Molecular Properties
| Compound Name | (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide |
| PubChem CID | 122182686 |
| Molecular Formula | C13H19BrO3S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide |
| SMILES | OC[C@@H](O)[C@H]1C[S+](Cc2ccccc2)C[C@H]1O.[Br-] |
| InChI | InChI=1S/C13H19O3S.BrH/c14-6-12(15)11-8-17(9-13(11)16)7-10-4-2-1-3-5-10;/h1-5,11-16H,6-9H2;1H/q+1;/p-1/t11-,12-,13-,17?;/m1./s1 |
| InChIKey | PVRNCZBMVUNDLU-GMMSXJOZSA-M |
| XLogP | -2.85 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide?
The IUPAC name of (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide (CID 122182686) is (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide.
What is the SMILES notation for (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide?
The canonical SMILES for (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide is OC[C@@H](O)[C@H]1C[S+](Cc2ccccc2)C[C@H]1O.[Br-].
What is the InChIKey of (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide?
The InChIKey is PVRNCZBMVUNDLU-GMMSXJOZSA-M. The full InChI is InChI=1S/C13H19O3S.BrH/c14-6-12(15)11-8-17(9-13(11)16)7-10-4-2-1-3-5-10;/h1-5,11-16H,6-9H2;1H/q+1;/p-1/t11-,12-,13-,17?;/m1./s1.
What are the key properties of (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide?
(1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide has a molecular weight of 335.26 g/mol, XLogP of -2.85, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(3R,4S)-1-benzyl-4-hydroxythiolan-1-ium-3-yl]ethane-1,2-diol bromide is sourced from PubChem (CID 122182686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).