C26H34O7S — CID 122182929
[(3aR,4S,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-3-(2-hydroxyethylsulfanylmethyl)-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl] benzoate (PubChem CID 122182929) has the molecular formula C26H34O7S and a molecular weight of 490.62 g/mol. Its IUPAC name is [(3aR,4S,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-3-(2-hydroxyethylsulfanylmethyl)-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl] benzoate.
| Compound Name | [(3aR,4S,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-3-(2-hydroxyethylsulfanylmethyl)-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl] benzoate |
|---|---|
| PubChem CID | 122182929 |
| Molecular Formula | C26H34O7S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(3aR,4S,7aR)-5-[(2S)-5-acetyloxypentan-2-yl]-3-(2-hydroxyethylsulfanylmethyl)-6-methyl-2-oxo-3a,4,7,7a-tetrahydro-3H-1-benzofuran-4-yl] benzoate |
| SMILES | CC(=O)OCCC[C@H](C)C1=C(C)C[C@H]2OC(=O)C(CSCCO)[C@H]2[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H34O7S/c1-16(8-7-12-31-18(3)28)22-17(2)14-21-23(20(26(30)32-21)15-34-13-11-27)24(22)33-25(29)19-9-5-4-6-10-19/h4-6,9-10,16,20-21,23-24,27H,7-8,11-15H2,1-3H3/t16-,20?,21+,23+,24+/m0/s1 |
| InChIKey | FFVDFGCSXCTFPA-SNCWXKDTSA-N |
| XLogP | 3.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|