C24H24F3N7O4 — CID 122182989
N-[3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-2-[4-[(3,4,5-trimethoxyanilino)methyl]triazol-1-yl]acetamide (PubChem CID 122182989) has the molecular formula C24H24F3N7O4 and a molecular weight of 531.50 g/mol. Its IUPAC name is N-[3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-2-[4-[(3,4,5-trimethoxyanilino)methyl]triazol-1-yl]acetamide.
| Compound Name | N-[3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-2-[4-[(3,4,5-trimethoxyanilino)methyl]triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 122182989 |
| Molecular Formula | C24H24F3N7O4 |
| Molecular Weight | 531.50 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | N-[3-phenyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-2-[4-[(3,4,5-trimethoxyanilino)methyl]triazol-1-yl]acetamide |
| SMILES | COc1cc(NCc2cn(CC(=O)Nc3c(-c4ccccc4)n[nH]c3C(F)(F)F)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C24H24F3N7O4/c1-36-17-9-15(10-18(37-2)22(17)38-3)28-11-16-12-34(33-30-16)13-19(35)29-21-20(14-7-5-4-6-8-14)31-32-23(21)24(25,26)27/h4-10,12,28H,11,13H2,1-3H3,(H,29,35)(H,31,32) |
| InChIKey | WRCQWPJOTSYFNW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|