C18H20N4 — CID 122183039
2-phenyl-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyrimidine (PubChem CID 122183039) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-phenyl-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyrimidine.
| Compound Name | 2-phenyl-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 122183039 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-phenyl-3-(piperidin-1-ylmethyl)imidazo[1,2-a]pyrimidine |
| SMILES | c1ccc(-c2nc3ncccn3c2CN2CCCCC2)cc1 |
| InChI | InChI=1S/C18H20N4/c1-3-8-15(9-4-1)17-16(14-21-11-5-2-6-12-21)22-13-7-10-19-18(22)20-17/h1,3-4,7-10,13H,2,5-6,11-12,14H2 |
| InChIKey | IRCHGQWLOMKSBX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |