C28H28N4O3 — CID 122183074
1-(4-tert-butylphenyl)-3-[3-[6-(4-methoxyphenyl)pyrazin-2-yl]oxyphenyl]urea (PubChem CID 122183074) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[3-[6-(4-methoxyphenyl)pyrazin-2-yl]oxyphenyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[3-[6-(4-methoxyphenyl)pyrazin-2-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 122183074 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[3-[6-(4-methoxyphenyl)pyrazin-2-yl]oxyphenyl]urea |
| SMILES | COc1ccc(-c2cncc(Oc3cccc(NC(=O)Nc4ccc(C(C)(C)C)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C28H28N4O3/c1-28(2,3)20-10-12-21(13-11-20)30-27(33)31-22-6-5-7-24(16-22)35-26-18-29-17-25(32-26)19-8-14-23(34-4)15-9-19/h5-18H,1-4H3,(H2,30,31,33) |
| InChIKey | ARZHAECIOKWALG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |