About 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole
5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole (PubChem CID 122183352) has the molecular formula C25H25NO4
and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole.
Molecular Properties
| Compound Name | 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
| PubChem CID | 122183352 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole |
| SMILES | COc1ccc2[nH]c(-c3ccccc3)c(Cc3cc(OC)c(OC)c(OC)c3)c2c1 |
| InChI | InChI=1S/C25H25NO4/c1-27-18-10-11-21-19(15-18)20(24(26-21)17-8-6-5-7-9-17)12-16-13-22(28-2)25(30-4)23(14-16)29-3/h5-11,13-15,26H,12H2,1-4H3 |
| InChIKey | XGKXJYIZUOJWBW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole?
The IUPAC name of 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole (CID 122183352) is 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole.
What is the SMILES notation for 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole?
The canonical SMILES for 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole is COc1ccc2[nH]c(-c3ccccc3)c(Cc3cc(OC)c(OC)c(OC)c3)c2c1.
What is the InChIKey of 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole?
The InChIKey is XGKXJYIZUOJWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO4/c1-27-18-10-11-21-19(15-18)20(24(26-21)17-8-6-5-7-9-17)12-16-13-22(28-2)25(30-4)23(14-16)29-3/h5-11,13-15,26H,12H2,1-4H3.
What are the key properties of 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole?
5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole has a molecular weight of 403.48 g/mol, XLogP of 5.46, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1H-indole is sourced from PubChem (CID 122183352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).