About 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one
3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one (PubChem CID 122183402) has the molecular formula C26H32N4O4
and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one |
| PubChem CID | 122183402 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CCCCCN1CCN(CCCn2c(=O)oc3ccccc32)CC1 |
| InChI | InChI=1S/C26H32N4O4/c31-25-29(21-9-2-4-11-23(21)33-25)15-7-1-6-13-27-17-19-28(20-18-27)14-8-16-30-22-10-3-5-12-24(22)34-26(30)32/h2-5,9-12H,1,6-8,13-20H2 |
| InChIKey | DCOMNHZMYXKQAK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one?
The IUPAC name of 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one (CID 122183402) is 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one is O=c1oc2ccccc2n1CCCCCN1CCN(CCCn2c(=O)oc3ccccc32)CC1.
What is the InChIKey of 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one?
The InChIKey is DCOMNHZMYXKQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N4O4/c31-25-29(21-9-2-4-11-23(21)33-25)15-7-1-6-13-27-17-19-28(20-18-27)14-8-16-30-22-10-3-5-12-24(22)34-26(30)32/h2-5,9-12H,1,6-8,13-20H2.
What are the key properties of 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one?
3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one has a molecular weight of 464.57 g/mol, XLogP of 3.38, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[4-[3-(2-oxo-1,3-benzoxazol-3-yl)propyl]piperazin-1-yl]pentyl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 122183402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).