C27H20O5 — CID 122183436
5-methyl-3-phenyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione (PubChem CID 122183436) has the molecular formula C27H20O5 and a molecular weight of 424.45 g/mol. Its IUPAC name is 5-methyl-3-phenyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione.
| Compound Name | 5-methyl-3-phenyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione |
|---|---|
| PubChem CID | 122183436 |
| Molecular Formula | C27H20O5 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 5-methyl-3-phenyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione |
| SMILES | Cc1cc2c(c3oc(=O)c(-c4ccccc4)cc13)C(=O)c1c(OC(C)C)cccc1C2=O |
| InChI | InChI=1S/C27H20O5/c1-14(2)31-21-11-7-10-17-22(21)25(29)23-20(24(17)28)12-15(3)18-13-19(27(30)32-26(18)23)16-8-5-4-6-9-16/h4-14H,1-3H3 |
| InChIKey | UGPMZVLPNAUBJK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|