About 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide
2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide (PubChem CID 122183510) has the molecular formula C20H22N2O2S
and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide |
| PubChem CID | 122183510 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide |
| SMILES | CCCN(CCC)C(=O)C(=O)c1c(-c2ccsc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-10-22(11-4-2)20(24)19(23)17-15-7-5-6-8-16(15)21-18(17)14-9-12-25-13-14/h5-9,12-13,21H,3-4,10-11H2,1-2H3 |
| InChIKey | GRVXEMZCNXREFR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide?
The IUPAC name of 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide (CID 122183510) is 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide.
What is the SMILES notation for 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide?
The canonical SMILES for 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide is CCCN(CCC)C(=O)C(=O)c1c(-c2ccsc2)[nH]c2ccccc12.
What is the InChIKey of 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide?
The InChIKey is GRVXEMZCNXREFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2S/c1-3-10-22(11-4-2)20(24)19(23)17-15-7-5-6-8-16(15)21-18(17)14-9-12-25-13-14/h5-9,12-13,21H,3-4,10-11H2,1-2H3.
What are the key properties of 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide?
2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide has a molecular weight of 354.48 g/mol, XLogP of 4.73, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N,N-dipropyl-2-(2-thiophen-3-yl-1H-indol-3-yl)acetamide is sourced from PubChem (CID 122183510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).