About (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione
(3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione (PubChem CID 122183676) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione.
Molecular Properties
| Compound Name | (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione |
| PubChem CID | 122183676 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione |
| SMILES | CCC(C)/C(O)=C1\C(=O)OC(C)C(C)C1=O |
| InChI | InChI=1S/C12H18O4/c1-5-6(2)10(13)9-11(14)7(3)8(4)16-12(9)15/h6-8,13H,5H2,1-4H3/b10-9+ |
| InChIKey | HRHXOJYXAMLRQF-MDZDMXLPSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione?
The IUPAC name of (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione (CID 122183676) is (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione.
What is the SMILES notation for (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione?
The canonical SMILES for (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione is CCC(C)/C(O)=C1\C(=O)OC(C)C(C)C1=O.
What is the InChIKey of (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione?
The InChIKey is HRHXOJYXAMLRQF-MDZDMXLPSA-N. The full InChI is InChI=1S/C12H18O4/c1-5-6(2)10(13)9-11(14)7(3)8(4)16-12(9)15/h6-8,13H,5H2,1-4H3/b10-9+.
What are the key properties of (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione?
(3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione has a molecular weight of 226.27 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1-hydroxy-2-methylbutylidene)-5,6-dimethyloxane-2,4-dione is sourced from PubChem (CID 122183676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).