About N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide (PubChem CID 122183767) has the molecular formula C24H25Cl2FN4O
and a molecular weight of 475.40 g/mol. Its IUPAC name is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide |
| PubChem CID | 122183767 |
| Molecular Formula | C24H25Cl2FN4O |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1cnc2ccc(F)cc2c1 |
| InChI | InChI=1S/C24H25Cl2FN4O/c25-20-4-3-5-22(23(20)26)31-12-10-30(11-13-31)9-2-1-8-28-24(32)18-14-17-15-19(27)6-7-21(17)29-16-18/h3-7,14-16H,1-2,8-13H2,(H,28,32) |
| InChIKey | OLJONOSWRLTMOI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide?
The IUPAC name of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide (CID 122183767) is N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide.
What is the SMILES notation for N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide?
The canonical SMILES for N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide is O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)c1cnc2ccc(F)cc2c1.
What is the InChIKey of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide?
The InChIKey is OLJONOSWRLTMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25Cl2FN4O/c25-20-4-3-5-22(23(20)26)31-12-10-30(11-13-31)9-2-1-8-28-24(32)18-14-17-15-19(27)6-7-21(17)29-16-18/h3-7,14-16H,1-2,8-13H2,(H,28,32).
What are the key properties of N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide?
N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide has a molecular weight of 475.40 g/mol, XLogP of 5.01, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-6-fluoroquinoline-3-carboxamide is sourced from PubChem (CID 122183767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).