C21H23NS — CID 122183838
2-[(E)-2-(3,4,5-triethylphenyl)ethenyl]-1,3-benzothiazole (PubChem CID 122183838) has the molecular formula C21H23NS and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-[(E)-2-(3,4,5-triethylphenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(3,4,5-triethylphenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 122183838 |
| Molecular Formula | C21H23NS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[(E)-2-(3,4,5-triethylphenyl)ethenyl]-1,3-benzothiazole |
| SMILES | CCc1cc(/C=C/c2nc3ccccc3s2)cc(CC)c1CC |
| InChI | InChI=1S/C21H23NS/c1-4-16-13-15(14-17(5-2)18(16)6-3)11-12-21-22-19-9-7-8-10-20(19)23-21/h7-14H,4-6H2,1-3H3/b12-11+ |
| InChIKey | DQKIMAWBUWDSIO-VAWYXSNFSA-N |
| XLogP | 6.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |