About 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one
6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one (PubChem CID 122183955) has the molecular formula C18H15N3OS3
and a molecular weight of 385.54 g/mol. Its IUPAC name is 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one |
| PubChem CID | 122183955 |
| Molecular Formula | C18H15N3OS3 |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one |
| SMILES | CSc1cccc(Nc2nc(-c3ccc4c(c3)NC(=O)CS4)cs2)c1 |
| InChI | InChI=1S/C18H15N3OS3/c1-23-13-4-2-3-12(8-13)19-18-21-15(9-25-18)11-5-6-16-14(7-11)20-17(22)10-24-16/h2-9H,10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | IXWLJARKLNKMQP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one?
The IUPAC name of 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one (CID 122183955) is 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one is CSc1cccc(Nc2nc(-c3ccc4c(c3)NC(=O)CS4)cs2)c1.
What is the InChIKey of 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one?
The InChIKey is IXWLJARKLNKMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3OS3/c1-23-13-4-2-3-12(8-13)19-18-21-15(9-25-18)11-5-6-16-14(7-11)20-17(22)10-24-16/h2-9H,10H2,1H3,(H,19,21)(H,20,22).
What are the key properties of 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one?
6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one has a molecular weight of 385.54 g/mol, XLogP of 5.32, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-methylsulfanylanilino)-1,3-thiazol-4-yl]-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 122183955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).