C49H44O10 — CID 122184078
[2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[(2R)-2-(6-methoxynaphthalen-2-yl)propanoyl]oxyphenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 122184078) has the molecular formula C49H44O10 and a molecular weight of 792.88 g/mol. Its IUPAC name is [2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[(2R)-2-(6-methoxynaphthalen-2-yl)propanoyl]oxyphenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | [2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[(2R)-2-(6-methoxynaphthalen-2-yl)propanoyl]oxyphenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 122184078 |
| Molecular Formula | C49H44O10 |
| Molecular Weight | 792.88 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | [2-methoxy-4-[(1E,6E)-7-[3-methoxy-4-[(2R)-2-(6-methoxynaphthalen-2-yl)propanoyl]oxyphenyl]-3,5-dioxohepta-1,6-dienyl]phenyl] (2R)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@@H](C)C(=O)Oc3ccc(/C=C/C(=O)CC(=O)/C=C/c4ccc(OC(=O)[C@H](C)c5ccc6cc(OC)ccc6c5)c(OC)c4)cc3OC)ccc2c1 |
| InChI | InChI=1S/C49H44O10/c1-30(34-11-13-38-27-42(54-3)19-15-36(38)25-34)48(52)58-44-21-9-32(23-46(44)56-5)7-17-40(50)29-41(51)18-8-33-10-22-45(47(24-33)57-6)59-49(53)31(2)35-12-14-39-28-43(55-4)20-16-37(39)26-35/h7-28,30-31H,29H2,1-6H3/b17-7+,18-8+/t30-,31-/m1/s1 |
| InChIKey | GMQYVGVNZGGUFG-ONZKXXOASA-N |
| XLogP | 9.70 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.88 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|