C24H29FN4O2 — CID 122184158
1-[5-(dipropylamino)-2-oxo-3-prop-2-enyl-1,3-dihydroindol-6-yl]-3-(4-fluorophenyl)urea (PubChem CID 122184158) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[5-(dipropylamino)-2-oxo-3-prop-2-enyl-1,3-dihydroindol-6-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[5-(dipropylamino)-2-oxo-3-prop-2-enyl-1,3-dihydroindol-6-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 122184158 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[5-(dipropylamino)-2-oxo-3-prop-2-enyl-1,3-dihydroindol-6-yl]-3-(4-fluorophenyl)urea |
| SMILES | C=CCC1C(=O)Nc2cc(NC(=O)Nc3ccc(F)cc3)c(N(CCC)CCC)cc21 |
| InChI | InChI=1S/C24H29FN4O2/c1-4-7-18-19-14-22(29(12-5-2)13-6-3)21(15-20(19)27-23(18)30)28-24(31)26-17-10-8-16(25)9-11-17/h4,8-11,14-15,18H,1,5-7,12-13H2,2-3H3,(H,27,30)(H2,26,28,31) |
| InChIKey | YHFKNYFCQNTYJN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|