C24H23ClF2N6O2 — CID 122184792
N-[3-[[[5-chloro-2-(2,5-difluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 122184792) has the molecular formula C24H23ClF2N6O2 and a molecular weight of 500.94 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-(2,5-difluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[[5-chloro-2-(2,5-difluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122184792 |
| Molecular Formula | C24H23ClF2N6O2 |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[3-[[[5-chloro-2-(2,5-difluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CNc2nc(Nc3cc(F)c(N4CCOCC4)cc3F)ncc2Cl)c1 |
| InChI | InChI=1S/C24H23ClF2N6O2/c1-2-22(34)30-16-5-3-4-15(10-16)13-28-23-17(25)14-29-24(32-23)31-20-11-19(27)21(12-18(20)26)33-6-8-35-9-7-33/h2-5,10-12,14H,1,6-9,13H2,(H,30,34)(H2,28,29,31,32) |
| InChIKey | PWFFZOZZKRXKPA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|