C23H40O4 — CID 122184836
(4S,5R,6R)-6-[(Z)-heptadec-8-enyl]-4,5,6-trihydroxycyclohex-2-en-1-one (PubChem CID 122184836) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (4S,5R,6R)-6-[(Z)-heptadec-8-enyl]-4,5,6-trihydroxycyclohex-2-en-1-one.
| Compound Name | (4S,5R,6R)-6-[(Z)-heptadec-8-enyl]-4,5,6-trihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 122184836 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (4S,5R,6R)-6-[(Z)-heptadec-8-enyl]-4,5,6-trihydroxycyclohex-2-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCC[C@]1(O)C(=O)C=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(27)21(25)18-17-20(24)22(23)26/h9-10,17-18,20,22,24,26-27H,2-8,11-16,19H2,1H3/b10-9-/t20-,22+,23-/m0/s1 |
| InChIKey | IYXBTKNDTJJVGH-XKHAUXSQSA-N |
| XLogP | 4.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|