C25H44O4 — CID 122184837
(4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-nonadec-10-enyl]cyclohex-2-en-1-one (PubChem CID 122184837) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is (4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-nonadec-10-enyl]cyclohex-2-en-1-one.
| Compound Name | (4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-nonadec-10-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 122184837 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | (4S,5R,6R)-4,5,6-trihydroxy-6-[(Z)-nonadec-10-enyl]cyclohex-2-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC[C@]1(O)C(=O)C=C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H44O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-25(29)23(27)20-19-22(26)24(25)28/h9-10,19-20,22,24,26,28-29H,2-8,11-18,21H2,1H3/b10-9-/t22-,24+,25-/m0/s1 |
| InChIKey | WSLKVXXQIATOBK-OKXJYCGPSA-N |
| XLogP | 5.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|