C22H30O2 — CID 122184963
(4aR,4bR,10bR,12aR)-9-hydroxy-1,1,4a,10b-tetramethyl-3,4,4b,5,6,11,12,12a-octahydrochrysen-2-one (PubChem CID 122184963) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (4aR,4bR,10bR,12aR)-9-hydroxy-1,1,4a,10b-tetramethyl-3,4,4b,5,6,11,12,12a-octahydrochrysen-2-one.
| Compound Name | (4aR,4bR,10bR,12aR)-9-hydroxy-1,1,4a,10b-tetramethyl-3,4,4b,5,6,11,12,12a-octahydrochrysen-2-one |
|---|---|
| PubChem CID | 122184963 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (4aR,4bR,10bR,12aR)-9-hydroxy-1,1,4a,10b-tetramethyl-3,4,4b,5,6,11,12,12a-octahydrochrysen-2-one |
| SMILES | CC1(C)C(=O)CC[C@]2(C)[C@H]3CCc4ccc(O)cc4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H30O2/c1-20(2)17-9-11-21(3)16-13-15(23)7-5-14(16)6-8-18(21)22(17,4)12-10-19(20)24/h5,7,13,17-18,23H,6,8-12H2,1-4H3/t17-,18-,21-,22-/m0/s1 |
| InChIKey | NGCQAWJJPMBLJJ-GPHNJDIKSA-N |
| XLogP | 5.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |