C19H24N4O4S — CID 122184989
[4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] sulfamate (PubChem CID 122184989) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is [4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] sulfamate.
| Compound Name | [4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] sulfamate |
|---|---|
| PubChem CID | 122184989 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [4-[[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]amino]phenyl] sulfamate |
| SMILES | Cc1cccc(N2CCN(C(=O)Nc3ccc(OS(N)(=O)=O)cc3)CC2)c1C |
| InChI | InChI=1S/C19H24N4O4S/c1-14-4-3-5-18(15(14)2)22-10-12-23(13-11-22)19(24)21-16-6-8-17(9-7-16)27-28(20,25)26/h3-9H,10-13H2,1-2H3,(H,21,24)(H2,20,25,26) |
| InChIKey | LIXCKEGDQZELHR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |