C21H21Cl2N3O2S2 — CID 122185238
4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide (PubChem CID 122185238) has the molecular formula C21H21Cl2N3O2S2 and a molecular weight of 482.46 g/mol. Its IUPAC name is 4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 122185238 |
| Molecular Formula | C21H21Cl2N3O2S2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 4-[[3-cyclohexyl-4-(2,4-dichlorophenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=c2\scc(-c3ccc(Cl)cc3Cl)n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2S2/c22-14-6-11-18(19(23)12-14)20-13-29-21(26(20)16-4-2-1-3-5-16)25-15-7-9-17(10-8-15)30(24,27)28/h6-13,16H,1-5H2,(H2,24,27,28)/b25-21- |
| InChIKey | DKSBNGHUMSUEKT-DAFNUICNSA-N |
| XLogP | 5.91 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|