C15H17F3O2 — CID 122185355
(3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(trifluoromethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 122185355) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(trifluoromethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(trifluoromethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 122185355 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (3aS,6E,10E,11aR)-10-methyl-3-methylidene-6-(trifluoromethyl)-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(/C(F)(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C15H17F3O2/c1-9-4-3-5-11(15(16,17)18)6-7-12-10(2)14(19)20-13(12)8-9/h5,8,12-13H,2-4,6-7H2,1H3/b9-8+,11-5+/t12-,13+/m0/s1 |
| InChIKey | URTUQAOYQCEQQN-XBHGFQMESA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|